Products 501-89-3
CAS 501-89-3 appears in our catalog under these names: 4-Carboxyphenylacetic acid, 98%, 4–Carboxyphenylacetic acid, 4-(Carboxymethyl)benzoic Acid, >98.0%(T), 4-Carboxyphenylacetic acid 97%, 4-Carboxymethylbenzoic Acid, 95%+, 95%+. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 100g, 5g, 1g, 10g, 500g.
4-(carboxymethyl)benzoic acid (CAS 501-89-3) is a chemical compound with the molecular formula C9H8O4 and a molecular weight of 180.16 g/mol. IUPAC name: 4-(carboxymethyl)benzoic acid. InChIKey: DMEDOWYXHVUPMO-UHFFFAOYSA-N.
| Molecular formula | C9H8O4 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-(carboxymethyl)benzoic acid |
| InChIKey | DMEDOWYXHVUPMO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC(=O)O)C(=O)O |
Computed by PubChem (NCBI)