Products 331830-20-7
CAS 331830-20-7 appears in our catalog under these names: 1,4-DPCA, 1,4-DPCA/ 97.75% (existing batch purity), 1,4–DPCA, 1,4-DPCA 98%, 1,4-DPCA, ≥98%, ≥98%. Offered by: TRC, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 1g, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
4-oxo-1H-1,10-phenanthroline-3-carboxylic acid (CAS 331830-20-7) is a chemical compound with the molecular formula C13H8N2O3 and a molecular weight of 240.21 g/mol. IUPAC name: 4-oxo-1H-1,10-phenanthroline-3-carboxylic acid. InChIKey: XZZHOJONZJQARN-UHFFFAOYSA-N.
| Molecular formula | C13H8N2O3 |
|---|---|
| Molecular weight | 240.21 g/mol |
| IUPAC name | 4-oxo-1H-1,10-phenanthroline-3-carboxylic acid |
| InChIKey | XZZHOJONZJQARN-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C3=C(C=C2)C(=O)C(=CN3)C(=O)O)N=C1 |
Computed by PubChem (NCBI)
Synonyms:
4-oxo-1H-1,10-phenanthroline-3-carboxylic acid, 4-Oxo-1,4-dihydro-1,10-phenanthroline-3-carboxylic acid, 4-oxo-1,4-dihydro-[1,10]phenanthroline-3-carboxylic acid, 1,4-Dihydro-4-oxo-[1,10]phenanthroline-3-carboxylic acid, 1,10-Phenanthroline-3-carboxylic acid, 1,4-dihydro-4-oxo-, 1,4-dihydrophenanthroline-4-one-3-carboxylic acid, 4-Hydroxy-1,10-phenanthroline-3-carboxylic acid