Products 3460-18-2
CAS 3460-18-2 appears in our catalog under these names: 1,4-Dibromo-2-nitrobenzene, 98% , 1,4-Dibromo-2-nitrobenzene 98%, 1,4-Dibromo-2-nitrobenzene, >98.0%(GC), 2,5–Dibromonitrobenzene, 2,5-Dibromonitrobenzene, 97%. Offered by: Thermo Scientific (Alfa Aesar), Ambeed, TCI, GLPBio, Thermo Scientific (Acros). Available pack sizes: 25g, 100g, 500g, 1000g, 250g, 1kg.
1,4-dibromo-2-nitrobenzene (CAS 3460-18-2) is a chemical compound with the molecular formula C6H3Br2NO2 and a molecular weight of 280.90 g/mol. IUPAC name: 1,4-dibromo-2-nitrobenzene. InChIKey: WRGKKASJBOREMB-UHFFFAOYSA-N.
| Molecular formula | C6H3Br2NO2 |
|---|---|
| Molecular weight | 280.90 g/mol |
| IUPAC name | 1,4-dibromo-2-nitrobenzene |
| InChIKey | WRGKKASJBOREMB-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)[N+](=O)[O-])Br |
Computed by PubChem (NCBI)