cas: 90418-64-7 — see every product listed under this CAS number, including other names
1,5-Naphthyridine-3-carboxylic acid, ≥95%, ≥95% (CAS 90418-64-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114DQW-50mg |
| cas | 90418-64-7 |
| size | 50mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 698.00 Pln | |
| Chemat | 100mg | 1125.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1,5-naphthyridine-3-carboxylic acid (CAS 90418-64-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,5-naphthyridine-3-carboxylic acid. InChIKey: BWIFRKKQXKCKQQ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,5-naphthyridine-3-carboxylic acid |
| InChIKey | BWIFRKKQXKCKQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)