CAS 90418-64-7 appears in our catalog under these names: 1,5-Naphthyridine-3-carboxylic acid, 95%, 1,5-Naphthyridine-3-carboxylic acid, 1,5-Naphthyridine-3-carboxylic acid, ≥95%, ≥95%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 0,5g, 50mg.
1,5-naphthyridine-3-carboxylic acid (CAS 90418-64-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,5-naphthyridine-3-carboxylic acid. InChIKey: BWIFRKKQXKCKQQ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,5-naphthyridine-3-carboxylic acid |
| InChIKey | BWIFRKKQXKCKQQ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)C(=O)O)N=C1 |
Computed by PubChem (NCBI)