CAS 99066-71-4 appears in our catalog under these names: 1,8-Naphthyridine-4-carboxylic acid, 95%, 1,8-Naphthyridine-4-carboxylic acid, 98+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 100mg, 1g, 5g.
1,8-naphthyridine-4-carboxylic acid (CAS 99066-71-4) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,8-naphthyridine-4-carboxylic acid. InChIKey: OHLKQPVOQXXCDW-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,8-naphthyridine-4-carboxylic acid |
| InChIKey | OHLKQPVOQXXCDW-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2N=C1)C(=O)O |
Computed by PubChem (NCBI)