CAS 13610-48-5 is the registry number for (2-Oxo-1,3-benzoxazol-3(2h)-yl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
2-(2-oxo-1,3-benzoxazol-3-yl)acetonitrile (CAS 13610-48-5) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 2-(2-oxo-1,3-benzoxazol-3-yl)acetonitrile. InChIKey: PLMOULRJKCIGCA-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 2-(2-oxo-1,3-benzoxazol-3-yl)acetonitrile |
| InChIKey | PLMOULRJKCIGCA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N(C(=O)O2)CC#N |
Computed by PubChem (NCBI)