CAS 21905-86-2 appears in our catalog under these names: Cinnoline-4-carboxylic acid, 95%, Cinnoline-4-carboxylic acid, 98%, Cinnoline-4-carboxylic acid, CINNOLINE-4-CARBOXYLIC ACID, 97%, cinnoline-4-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: 100mg, 250mg, 1g, 10g, 5g, 2,5g.
Cinnoline-4-carboxylic acid (CAS 21905-86-2) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: cinnoline-4-carboxylic acid. InChIKey: ZKOMQFDQFTVPBZ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | cinnoline-4-carboxylic acid |
| InChIKey | ZKOMQFDQFTVPBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=N2)C(=O)O |
Computed by PubChem (NCBI)