CAS 74048-24-1 appears in our catalog under these names: 1,6-Naphthyridine-5-carboxylic acid, 95%, 1,6-Naphthyridine-5-carboxylic acid, 95+%, 1,6-Naphthyridine-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2.5g.
1,6-naphthyridine-5-carboxylic acid (CAS 74048-24-1) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,6-naphthyridine-5-carboxylic acid. InChIKey: GZZARNGHJBDZPR-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,6-naphthyridine-5-carboxylic acid |
| InChIKey | GZZARNGHJBDZPR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CN=C2C(=O)O)N=C1 |
Computed by PubChem (NCBI)