Products 1019115-06-0

CAS 1019115-06-0 appears in our catalog under these names: 1,7-Naphthyridine-5-carboxylic acid, 95%, 1,7-Naphthyridine-5-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

1,7-naphthyridine-5-carboxylic acid (CAS 1019115-06-0) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,7-naphthyridine-5-carboxylic acid. InChIKey: STZQRNFPHRFHLF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6N2O2
Molecular weight174.16 g/mol
IUPAC name1,7-naphthyridine-5-carboxylic acid
InChIKeySTZQRNFPHRFHLF-UHFFFAOYSA-N
SMILESC1=CC2=C(C=NC=C2C(=O)O)N=C1

Computed by PubChem (NCBI)