Products 250674-49-8
CAS 250674-49-8 appears in our catalog under these names: 1,7-Naphthyridine-3-carboxylic acid, 95%, 1，7–Naphthyridine–3–carboxylic acid, 1,7-Naphthyridine-3-carboxylic acid, 1,7-Naphthyridine-3-carboxylic acid 97%, 1,7-Naphthyridine-3-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg, 25mg, 5g.
1,7-naphthyridine-3-carboxylic acid (CAS 250674-49-8) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,7-naphthyridine-3-carboxylic acid. InChIKey: HJYYQFVLSQWEDJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,7-naphthyridine-3-carboxylic acid |
| InChIKey | HJYYQFVLSQWEDJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=NC=C(C=C21)C(=O)O |
Computed by PubChem (NCBI)