cas: 1017793-59-7 — see every product listed under this CAS number, including other names
1,6-Naphthyridine-3-carboxylic acid, 98%, 98% (CAS 1017793-59-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1116KH-100mg |
| cas | 1017793-59-7 |
| size | 100mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 486.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1,6-naphthyridine-3-carboxylic acid (CAS 1017793-59-7) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,6-naphthyridine-3-carboxylic acid. InChIKey: DTQIBVJDCJZFTK-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,6-naphthyridine-3-carboxylic acid |
| InChIKey | DTQIBVJDCJZFTK-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=CC(=CN=C21)C(=O)O |
Computed by PubChem (NCBI)