1,7-Naphthyridine-3-carboxylic acid, 98%
cas: 250674-49-8 — see every product listed under this CAS number, including other names
1,7-Naphthyridine-3-carboxylic acid, 98% (CAS 250674-49-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F788289-100MG |
| cas | 250674-49-8 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 732.05 Pln | |
| Fluorochem | 250mg | 1190.22 Pln | |
| Fluorochem | 1g | 3486.29 Pln | |
| Fluorochem | 5g | 12321.72 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1,7-naphthyridine-3-carboxylic acid (CAS 250674-49-8) is a chemical compound with the molecular formula C9H6N2O2 and a molecular weight of 174.16 g/mol. IUPAC name: 1,7-naphthyridine-3-carboxylic acid. InChIKey: HJYYQFVLSQWEDJ-UHFFFAOYSA-N.
| Molecular formula | C9H6N2O2 |
|---|---|
| Molecular weight | 174.16 g/mol |
| IUPAC name | 1,7-naphthyridine-3-carboxylic acid |
| InChIKey | HJYYQFVLSQWEDJ-UHFFFAOYSA-N |
| SMILES | C1=CN=CC2=NC=C(C=C21)C(=O)O |
Computed by PubChem (NCBI)