cas: 40288-65-1 — see every product listed under this CAS number, including other names
1-(1,3-benzodioxol-5-yl)-2-bromoethanone, 97% (CAS 40288-65-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F358018-250MG |
| cas | 40288-65-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 513.38 Pln | |
| Fluorochem | 2.5g | 1200.64 Pln | |
| Fluorochem | 5g | 2346.07 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
1-(1,3-benzodioxol-5-yl)-2-bromoethanone (CAS 40288-65-1) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2-bromoethanone. InChIKey: QBXCVQVFPVXAGS-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2-bromoethanone |
| InChIKey | QBXCVQVFPVXAGS-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)C(=O)CBr |
Computed by PubChem (NCBI)