CAS 1043418-95-6 appears in our catalog under these names: Methyl 2-bromo-5-formylbenzoate, 95%, 95%, Methyl 2-bromo-5-formylbenzoate, 95%, Methyl 2-bromo-5-formylbenzoate 95%, Methyl 2–bromo–5–formylbenzoate, METHYL 2-BROMO-5-FORMYLBENZOATE, 97%. Offered by: Chemat, Combi-blocks, Ambeed, GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Methyl 2-bromo-5-formylbenzoate (CAS 1043418-95-6) is a chemical compound with the molecular formula C9H7BrO3 and a molecular weight of 243.05 g/mol. IUPAC name: methyl 2-bromo-5-formylbenzoate. InChIKey: XQOANPCORUKMQY-UHFFFAOYSA-N.
| Molecular formula | C9H7BrO3 |
|---|---|
| Molecular weight | 243.05 g/mol |
| IUPAC name | methyl 2-bromo-5-formylbenzoate |
| InChIKey | XQOANPCORUKMQY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)C=O)Br |
Computed by PubChem (NCBI)