cas: 945244-30-4 — see every product listed under this CAS number, including other names
1-(1,3-dioxaindan-5-yl)cyclopentane-1-carboxylic acid, ≥95%, ≥95% (CAS 945244-30-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12EMYS-1g |
| cas | 945244-30-4 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 2094.80 Pln | |
| Chemat | 5g | 4715.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
1-(1,3-benzodioxol-5-yl)cyclopentane-1-carboxylic acid (CAS 945244-30-4) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclopentane-1-carboxylic acid. InChIKey: JBUHPCVBAHVTCW-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)cyclopentane-1-carboxylic acid |
| InChIKey | JBUHPCVBAHVTCW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)