Products 152034-52-1
CAS 152034-52-1 is the registry number for Methyl 4-(2,4-dimethylphenyl)-2,4-dioxobutanoate, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
Methyl 4-(2,4-dimethylphenyl)-2,4-dioxobutanoate (CAS 152034-52-1) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: methyl 4-(2,4-dimethylphenyl)-2,4-dioxobutanoate. InChIKey: NBMVKWZVBCWVIN-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | methyl 4-(2,4-dimethylphenyl)-2,4-dioxobutanoate |
| InChIKey | NBMVKWZVBCWVIN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)CC(=O)C(=O)OC)C |
Computed by PubChem (NCBI)