CAS 6336-53-4 appears in our catalog under these names: 4,7-Dioxo-7-phenylheptanoic acid, 95%, 4,7-Dioxo-7-phenylheptanoic acid, 97%, 4,7-Dioxo-7-phenylheptanoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 10g, 250mg, 5g, 100mg, 0,5g.
4,7-dioxo-7-phenylheptanoic acid (CAS 6336-53-4) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 4,7-dioxo-7-phenylheptanoic acid. InChIKey: DCNLNHPQCXZOHD-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 4,7-dioxo-7-phenylheptanoic acid |
| InChIKey | DCNLNHPQCXZOHD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)CCC(=O)CCC(=O)O |
Computed by PubChem (NCBI)