Products 276888-00-7

CAS 276888-00-7 is the registry number for 2,2-Dimethyl 1,3-dihydroindene-2,2-dicarboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.

Structural formula: {0} (CAS {1})

Dimethyl 1,3-dihydroindene-2,2-dicarboxylate (CAS 276888-00-7) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: dimethyl 1,3-dihydroindene-2,2-dicarboxylate. InChIKey: PGPSCACBHUTBEE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O4
Molecular weight234.25 g/mol
IUPAC namedimethyl 1,3-dihydroindene-2,2-dicarboxylate
InChIKeyPGPSCACBHUTBEE-UHFFFAOYSA-N
SMILESCOC(=O)C1(CC2=CC=CC=C2C1)C(=O)OC

Computed by PubChem (NCBI)