Products 115375-24-1

CAS 115375-24-1 is the registry number for (2E)-3-[3-Methoxy-4-(prop-2-en-1-yloxy)phenyl]prop-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoic acid (CAS 115375-24-1) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: (E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoic acid. InChIKey: XCJIINFOALCIPH-FNORWQNLSA-N.

Identity
Molecular formulaC13H14O4
Molecular weight234.25 g/mol
IUPAC name(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoic acid
InChIKeyXCJIINFOALCIPH-FNORWQNLSA-N
SMILESCOC1=C(C=CC(=C1)/C=C/C(=O)O)OCC=C

Computed by PubChem (NCBI)