CAS 14125-70-3 appears in our catalog under these names: 4,6-O-Benzylidene-d-glucal, 95%, 4,6-O-Benzylidene-D-glucal, 97% . Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar). Available pack sizes: 250mg, 1g, 5g.
(4aR,8R,8aS)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol (CAS 14125-70-3) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: (4aR,8R,8aS)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol. InChIKey: XMDUTBYCCVWPLD-FKJOKYEKSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | (4aR,8R,8aS)-2-phenyl-4,4a,8,8a-tetrahydropyrano[3,2-d][1,3]dioxin-8-ol |
| InChIKey | XMDUTBYCCVWPLD-FKJOKYEKSA-N |
| SMILES | C1[C@@H]2[C@H]([C@@H](C=CO2)O)OC(O1)C3=CC=CC=C3 |
Computed by PubChem (NCBI)