CAS 945244-30-4 appears in our catalog under these names: 1-(1,3-Benzodioxol-5-yl)cyclopentanecarboxylic acid, 95%, 1-(1,3-dioxaindan-5-yl)cyclopentane-1-carboxylic acid, ≥95%, ≥95%, 1-(Benzo[d][1,3]dioxol-5-yl)cyclopentane-1-carboxylic acid. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
1-(1,3-benzodioxol-5-yl)cyclopentane-1-carboxylic acid (CAS 945244-30-4) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclopentane-1-carboxylic acid. InChIKey: JBUHPCVBAHVTCW-UHFFFAOYSA-N.
| Molecular formula | C13H14O4 |
|---|---|
| Molecular weight | 234.25 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)cyclopentane-1-carboxylic acid |
| InChIKey | JBUHPCVBAHVTCW-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)