Products 2140326-69-6

CAS 2140326-69-6 is the registry number for 3-(Methoxycarbonyl)-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-methoxycarbonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid (CAS 2140326-69-6) is a chemical compound with the molecular formula C13H14O4 and a molecular weight of 234.25 g/mol. IUPAC name: 3-methoxycarbonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid. InChIKey: ONRPCLCSZUPLSM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O4
Molecular weight234.25 g/mol
IUPAC name3-methoxycarbonyl-5,6,7,8-tetrahydronaphthalene-2-carboxylic acid
InChIKeyONRPCLCSZUPLSM-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C2CCCCC2=C1)C(=O)O

Computed by PubChem (NCBI)