cas: 89981-74-8 — see every product listed under this CAS number, including other names
1-(2,4-Dichlorophenyl)ethanamine hydrochloride, 98% (CAS 89981-74-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F546805-100MG |
| cas | 89981-74-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 159.34 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 1039.24 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(2,4-dichlorophenyl)ethanamine;hydrochloride (CAS 89981-74-8) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)ethanamine;hydrochloride. InChIKey: ZMGHOINUDXICQX-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | ZMGHOINUDXICQX-UHFFFAOYSA-N |
| SMILES | CC(C1=C(C=C(C=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)