cas: 32937-55-6 — see every product listed under this CAS number, including other names
1-(2,5-Dibromophenyl)ethanone 97% (CAS 32937-55-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A774830-1g |
| cas | 32937-55-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1126.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A774830 |
1-(2,5-dibromophenyl)ethanone (CAS 32937-55-6) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 277.94 g/mol. IUPAC name: 1-(2,5-dibromophenyl)ethanone. InChIKey: QFXROJNBTPMHSS-UHFFFAOYSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 277.94 g/mol |
| IUPAC name | 1-(2,5-dibromophenyl)ethanone |
| InChIKey | QFXROJNBTPMHSS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C=CC(=C1)Br)Br |
Computed by PubChem (NCBI)