cas: 1249591-96-5 — see every product listed under this CAS number, including other names
1-(2-Chlorophenyl)-2-(methylsulfonyl)ethan-1-ol (CAS 1249591-96-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F767506-100MG |
| cas | 1249591-96-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 752.88 Pln | |
| Fluorochem | 250mg | 877.83 Pln | |
| Fluorochem | 1g | 1846.24 Pln | |
| Fluorochem | 5g | 5579.30 Pln |
| delivery time | 3-4 weeks |
|---|
1-(2-chlorophenyl)-2-methylsulfonylethanol (CAS 1249591-96-5) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 1-(2-chlorophenyl)-2-methylsulfonylethanol. InChIKey: LKUZWZSOBAZUTG-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 1-(2-chlorophenyl)-2-methylsulfonylethanol |
| InChIKey | LKUZWZSOBAZUTG-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CC(C1=CC=CC=C1Cl)O |
Computed by PubChem (NCBI)