CAS 84911-01-3 appears in our catalog under these names: 3-Ethyl-4-methoxybenzenesulfonyl chloride, 95%, 3-Ethyl-4-methoxybenzene-1-sulfonyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
3-ethyl-4-methoxybenzenesulfonyl chloride (CAS 84911-01-3) is a chemical compound with the molecular formula C9H11ClO3S and a molecular weight of 234.70 g/mol. IUPAC name: 3-ethyl-4-methoxybenzenesulfonyl chloride. InChIKey: LKFURLPDNDFSNK-UHFFFAOYSA-N.
| Molecular formula | C9H11ClO3S |
|---|---|
| Molecular weight | 234.70 g/mol |
| IUPAC name | 3-ethyl-4-methoxybenzenesulfonyl chloride |
| InChIKey | LKFURLPDNDFSNK-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)S(=O)(=O)Cl)OC |
Computed by PubChem (NCBI)