cas: 306298-00-0 — see every product listed under this CAS number, including other names
1-(2-Fluorophenyl)cyclopropanecarboxylic acid 98% (CAS 306298-00-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A995617-250mg |
| cas | 306298-00-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 542.81 Pln | |
| Ambeed | 5g | 1616.38 Pln | |
| Ambeed | 10g | 2584.25 Pln | |
| Ambeed | 25g | 5098.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A995617 |
1-(2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 306298-00-0) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: MVQOOJNHXHBCGK-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | MVQOOJNHXHBCGK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)