CAS 306298-00-0 appears in our catalog under these names: 1-(2-Fluorophenyl)cyclopropane-1-carboxylic acid, 98%, 1–(2–Fluorophenyl)cyclopropanecarboxylic acid, 1-(2-Fluorophenyl)cyclopropanecarboxylic acid 98%, Cyclopropanecarboxylic acid, 1-(2-fluorophenyl)-, 95%, 95%, 1-(2-Fluorophenyl)cyclopropanecarboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg, 25g.
1-(2-fluorophenyl)cyclopropane-1-carboxylic acid (CAS 306298-00-0) is a chemical compound with the molecular formula C10H9FO2 and a molecular weight of 180.17 g/mol. IUPAC name: 1-(2-fluorophenyl)cyclopropane-1-carboxylic acid. InChIKey: MVQOOJNHXHBCGK-UHFFFAOYSA-N.
| Molecular formula | C10H9FO2 |
|---|---|
| Molecular weight | 180.17 g/mol |
| IUPAC name | 1-(2-fluorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | MVQOOJNHXHBCGK-UHFFFAOYSA-N |
| SMILES | C1CC1(C2=CC=CC=C2F)C(=O)O |
Computed by PubChem (NCBI)