cas: 79252-84-9 — see every product listed under this CAS number, including other names
1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione, 95% (CAS 79252-84-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F210124-1G |
| cas | 79252-84-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 502.97 Pln | |
| Fluorochem | 5g | 1684.84 Pln | |
| Fluorochem | 25g | 5032.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
1-(2-hydroxyphenyl)pyrrolidine-2,5-dione (CAS 79252-84-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-(2-hydroxyphenyl)pyrrolidine-2,5-dione. InChIKey: QGMHYVXVMJXSEK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-(2-hydroxyphenyl)pyrrolidine-2,5-dione |
| InChIKey | QGMHYVXVMJXSEK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)