Products 79252-84-9
CAS 79252-84-9 appears in our catalog under these names: 1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione, 98%, 1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione, 1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione 98%, 1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione, 95%, 95%, 1-(2-Hydroxyphenyl)pyrrolidine-2,5-dione, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg, 100mg.
1-(2-hydroxyphenyl)pyrrolidine-2,5-dione (CAS 79252-84-9) is a chemical compound with the molecular formula C10H9NO3 and a molecular weight of 191.18 g/mol. IUPAC name: 1-(2-hydroxyphenyl)pyrrolidine-2,5-dione. InChIKey: QGMHYVXVMJXSEK-UHFFFAOYSA-N.
| Molecular formula | C10H9NO3 |
|---|---|
| Molecular weight | 191.18 g/mol |
| IUPAC name | 1-(2-hydroxyphenyl)pyrrolidine-2,5-dione |
| InChIKey | QGMHYVXVMJXSEK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C2=CC=CC=C2O |
Computed by PubChem (NCBI)