cas: 91252-27-6 — see every product listed under this CAS number, including other names
1-(3,4-Dimethoxyphenyl)ethanamine hydrochloride 95% (CAS 91252-27-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A407935-100mg |
| cas | 91252-27-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 231.31 Pln | |
| Ambeed | 250mg | 292.50 Pln | |
| Ambeed | 1g | 337.00 Pln | |
| Ambeed | 5g | 726.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A407935 |
1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride (CAS 91252-27-6) is a chemical compound with the molecular formula C10H16ClNO2 and a molecular weight of 217.69 g/mol. IUPAC name: 1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride. InChIKey: PQHFDOBOSKIMTO-UHFFFAOYSA-N.
| Molecular formula | C10H16ClNO2 |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 1-(3,4-dimethoxyphenyl)ethanamine;hydrochloride |
| InChIKey | PQHFDOBOSKIMTO-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=C(C=C1)OC)OC)N.Cl |
Computed by PubChem (NCBI)