cas: 321318-36-9 — see every product listed under this CAS number, including other names
1-(3,5-Dichlorophenyl)ethan-1-amine hydrochloride, 98% (CAS 321318-36-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F772729-250MG |
| cas | 321318-36-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 185.37 Pln | |
| Fluorochem | 1g | 404.04 Pln | |
| Fluorochem | 5g | 1794.18 Pln | |
| Fluorochem | 10g | 3533.15 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(3,5-dichlorophenyl)ethanamine;hydrochloride (CAS 321318-36-9) is a chemical compound with the molecular formula C8H10Cl3N and a molecular weight of 226.5 g/mol. IUPAC name: 1-(3,5-dichlorophenyl)ethanamine;hydrochloride. InChIKey: YKPAICVWOBWQTG-UHFFFAOYSA-N.
| Molecular formula | C8H10Cl3N |
|---|---|
| Molecular weight | 226.5 g/mol |
| IUPAC name | 1-(3,5-dichlorophenyl)ethanamine;hydrochloride |
| InChIKey | YKPAICVWOBWQTG-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC(=C1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)