cas: 143328-21-6 — see every product listed under this CAS number, including other names
1-(3-Chlorophenyl)cyclopentanecarboxylic acid 97% (CAS 143328-21-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A391873-1g |
| cas | 143328-21-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 960.00 Pln | |
| Ambeed | 10g | 1772.12 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A391873 |
1-(3-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 143328-21-6) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: GGEPQYZXKVJSEX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | GGEPQYZXKVJSEX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)