Products 143328-21-6
CAS 143328-21-6 appears in our catalog under these names: 1-(3-Chlorophenyl)cyclopentane-1-carboxylic acid, 97%, 1–(3–Chlorophenyl)cyclopentane–1–carboxylic acid, 1-(3-Chlorophenyl)cyclopentanecarboxylic acid 97%, 1-(3-Chlorophenyl)cyclopentanecarboxylic acid, 98%, 98%, 1-(3-Chlorophenyl)cyclopentanecarboxylic acid, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 250mg, 10g, 5g, 1g, 100mg, 500mg.
1-(3-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 143328-21-6) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(3-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: GGEPQYZXKVJSEX-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(3-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | GGEPQYZXKVJSEX-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)