CAS 2420454-91-5 appears in our catalog under these names: Ketamine Impurity 3, 2-(R)-Hydroxy-2-(o-chlorophenyl)cyclohexanone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
(2R)-2-(2-chlorophenyl)-2-hydroxycyclohexan-1-one (CAS 2420454-91-5) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: (2R)-2-(2-chlorophenyl)-2-hydroxycyclohexan-1-one. InChIKey: TXHGZWYEGMFTJB-GFCCVEGCSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | (2R)-2-(2-chlorophenyl)-2-hydroxycyclohexan-1-one |
| InChIKey | TXHGZWYEGMFTJB-GFCCVEGCSA-N |
| SMILES | C1CC[C@](C(=O)C1)(C2=CC=CC=C2Cl)O |
Computed by PubChem (NCBI)