CAS 1105703-73-8 is the registry number for 4-(4-Chlorophenyl)-2-butenoic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Ethyl (E)-4-(4-chlorophenyl)but-2-enoate (CAS 1105703-73-8) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: ethyl (E)-4-(4-chlorophenyl)but-2-enoate. InChIKey: DFCNNAZQKCVOON-HWKANZROSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | ethyl (E)-4-(4-chlorophenyl)but-2-enoate |
| InChIKey | DFCNNAZQKCVOON-HWKANZROSA-N |
| SMILES | CCOC(=O)/C=C/CC1=CC=C(C=C1)Cl |
Computed by PubChem (NCBI)