CAS 1353741-11-3 is the registry number for Methyl 5-chloro-5,6,7,8-tetrahydronaphthalene-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 5-chloro-5,6,7,8-tetrahydronaphthalene-2-carboxylate (CAS 1353741-11-3) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: methyl 5-chloro-5,6,7,8-tetrahydronaphthalene-2-carboxylate. InChIKey: LBTNQQOKMVFVDG-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | methyl 5-chloro-5,6,7,8-tetrahydronaphthalene-2-carboxylate |
| InChIKey | LBTNQQOKMVFVDG-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(C=C1)C(CCC2)Cl |
Computed by PubChem (NCBI)