Products 1160257-34-0
CAS 1160257-34-0 is the registry number for 2-(2,3-Dihydro-1h-inden-5-yloxy)propanoyl chloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2-(2,3-dihydro-1H-inden-5-yloxy)propanoyl chloride (CAS 1160257-34-0) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 2-(2,3-dihydro-1H-inden-5-yloxy)propanoyl chloride. InChIKey: JNHPAGIXYJDLQL-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 2-(2,3-dihydro-1H-inden-5-yloxy)propanoyl chloride |
| InChIKey | JNHPAGIXYJDLQL-UHFFFAOYSA-N |
| SMILES | CC(C(=O)Cl)OC1=CC2=C(CCC2)C=C1 |
Computed by PubChem (NCBI)