CAS 80789-69-1 appears in our catalog under these names: 1–(4–Chlorophenyl)–1–cyclopentanecarboxylic Acid, 1-(4-Chlorophenyl)-1-cyclopentanecarboxylic acid, 98%, 1-(4-Chlorophenyl)cyclopentane-1-carboxylic acid, 98%, 1-(4-Chlorophenyl)cyclopentanecarboxylic acid, 95%, 1-(4-Chlorophenyl)cyclopentanecarboxylic acid, 95%, 95%. Offered by: GLPBio, Thermo Scientific (Acros), Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 100g, 1g, 10g, 50g.
1-(4-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 80789-69-1) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: QJNFJEMGWIQMJT-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO2 |
|---|---|
| Molecular weight | 224.68 g/mol |
| IUPAC name | 1-(4-chlorophenyl)cyclopentane-1-carboxylic acid |
| InChIKey | QJNFJEMGWIQMJT-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)(C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)