Products 143328-20-5

CAS 143328-20-5 is the registry number for 1-(2-chlorophenyl)cyclopentane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

1-(2-chlorophenyl)cyclopentane-1-carboxylic acid (CAS 143328-20-5) is a chemical compound with the molecular formula C12H13ClO2 and a molecular weight of 224.68 g/mol. IUPAC name: 1-(2-chlorophenyl)cyclopentane-1-carboxylic acid. InChIKey: IDXLMFIWSAQQEK-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClO2
Molecular weight224.68 g/mol
IUPAC name1-(2-chlorophenyl)cyclopentane-1-carboxylic acid
InChIKeyIDXLMFIWSAQQEK-UHFFFAOYSA-N
SMILESC1CCC(C1)(C2=CC=CC=C2Cl)C(=O)O

Computed by PubChem (NCBI)