cas: 92259-19-3 — see every product listed under this CAS number, including other names
1-(3-Nitrophenyl)ethanamine hydrochloride, 98% (CAS 92259-19-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F321472-250MG |
| cas | 92259-19-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 320.74 Pln | |
| Fluorochem | 1g | 591.48 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-(3-nitrophenyl)ethanamine;hydrochloride (CAS 92259-19-3) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: 1-(3-nitrophenyl)ethanamine;hydrochloride. InChIKey: IKBMZMKEBCIDPD-UHFFFAOYSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | 1-(3-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | IKBMZMKEBCIDPD-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)