CAS 839709-98-7 appears in our catalog under these names: (S)-3-Nitrophenethylamine hydrochloride, 95%, (S)-1-(3-Nitrophenyl)ethanamine HCl, (S)-1-(3-Nitrophenyl)ethanamine hydrochloride 95%, (S)-1-(3-Nitrophenyl)ethanamine hydrochloride, 95%, 95%, (S)-1-(3-Nitrophenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 10g, 5g.
(1S)-1-(3-nitrophenyl)ethanamine;hydrochloride (CAS 839709-98-7) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1S)-1-(3-nitrophenyl)ethanamine;hydrochloride. InChIKey: IKBMZMKEBCIDPD-RGMNGODLSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1S)-1-(3-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | IKBMZMKEBCIDPD-RGMNGODLSA-N |
| SMILES | C[C@@H](C1=CC(=CC=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)