CAS 1037092-07-1 appears in our catalog under these names: (R)-1-(3-NITROPHENYL)ETHAN-1-AMINE HCL, 98%, (1R)-1-(3-nitrophenyl)ethanamine hydrochloride, 98%, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(1R)-1-(3-nitrophenyl)ethanamine;hydrochloride (CAS 1037092-07-1) is a chemical compound with the molecular formula C8H11ClN2O2 and a molecular weight of 202.64 g/mol. IUPAC name: (1R)-1-(3-nitrophenyl)ethanamine;hydrochloride. InChIKey: IKBMZMKEBCIDPD-FYZOBXCZSA-N.
| Molecular formula | C8H11ClN2O2 |
|---|---|
| Molecular weight | 202.64 g/mol |
| IUPAC name | (1R)-1-(3-nitrophenyl)ethanamine;hydrochloride |
| InChIKey | IKBMZMKEBCIDPD-FYZOBXCZSA-N |
| SMILES | C[C@H](C1=CC(=CC=C1)[N+](=O)[O-])N.Cl |
Computed by PubChem (NCBI)