cas: 83882-67-1 — see every product listed under this CAS number, including other names
1-(4-(Difluoromethoxy)phenyl)ethanone 97% (CAS 83882-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A123896-250mg |
| cas | 83882-67-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 286.94 Pln | |
| Ambeed | 25g | 487.19 Pln | |
| Ambeed | 100g | 1510.69 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A123896 |
1-[4-(difluoromethoxy)phenyl]ethanone (CAS 83882-67-1) is a chemical compound with the molecular formula C9H8F2O2 and a molecular weight of 186.15 g/mol. IUPAC name: 1-[4-(difluoromethoxy)phenyl]ethanone. InChIKey: GIGWRVLNOYPOIT-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O2 |
|---|---|
| Molecular weight | 186.15 g/mol |
| IUPAC name | 1-[4-(difluoromethoxy)phenyl]ethanone |
| InChIKey | GIGWRVLNOYPOIT-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)OC(F)F |
Computed by PubChem (NCBI)