1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95%
cas: 15996-85-7 — see every product listed under this CAS number, including other names
1-(4-(Trifluoromethyl)phenyl)ethanamine hydrochloride, 95%, 95% (CAS 15996-85-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12DDUZ-1g |
| cas | 15996-85-7 |
| size | 1g |
| availability | 2g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 750.80 Pln | |
| Chemat | 100mg | 270.80 Pln | |
| Chemat | 250mg | 405.20 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride (CAS 15996-85-7) is a chemical compound with the molecular formula C9H11ClF3N and a molecular weight of 225.64 g/mol. IUPAC name: 1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride. InChIKey: JVLWNYKROJNLAS-UHFFFAOYSA-N.
| Molecular formula | C9H11ClF3N |
|---|---|
| Molecular weight | 225.64 g/mol |
| IUPAC name | 1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride |
| InChIKey | JVLWNYKROJNLAS-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
1-(4-(trifluoromethyl)phenyl)ethanamine hydrochloride, 1-(4-(trifluoromethyl)phenyl)ethan-1-amine hydrochloride, 1-[4-(trifluoromethyl)phenyl]ethanamine hydrochloride, 1-[4-(trifluoromethyl)phenyl]ethanamine;hydrochloride, (S)-1-(4-(Trifluoromethyl)phenyl)-ethanamine hydrochloride, 1-[4-(trifluoromethyl)phenyl]ethan-1-amine hydrochloride, (1S)-1-[4-(Trifluoromethyl)phenyl]ethanamine hydrochloride, 1-(4-(Trifluoromethyl)phenyl)ethanamine HCl, alpha-methyl-p-trifluoromethylbenzylamine hydrochloride