cas: 18640-58-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-nitrophenyl)ethanone, 95% (CAS 18640-58-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F222931-1G |
| cas | 18640-58-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 164.54 Pln | |
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 351.98 Pln | |
| Fluorochem | 100g | 1185.02 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-bromo-3-nitrophenyl)ethanone (CAS 18640-58-9) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 1-(4-bromo-3-nitrophenyl)ethanone. InChIKey: YFVOFFKNHQTQQE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(4-bromo-3-nitrophenyl)ethanone |
| InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)