1-(4-Bromo-3-nitrophenyl)ethanone, 98%
cas: 18640-58-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-nitrophenyl)ethanone, 98% (CAS 18640-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A135550-250mg |
| cas | 18640-58-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 125.62 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 337.00 Pln | |
| Ambeed | 100g | 1104.63 Pln | |
| Ambeed | 500g | 4720.25 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 160.40 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 50g | 496.40 Pln | |
| Chemat | 100g | 890.00 Pln | |
| Chemat | 500g | 3595.20 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 169.96 Pln | |
| BLDpharm | 10g | 269.93 Pln | |
| BLDpharm | 25g | 353.23 Pln | |
| BLDpharm | 100g | 1180.72 Pln | |
| BLDpharm | 500g | 5084.90 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
1-(4-bromo-3-nitrophenyl)ethanone (CAS 18640-58-9) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 1-(4-bromo-3-nitrophenyl)ethanone. InChIKey: YFVOFFKNHQTQQE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(4-bromo-3-nitrophenyl)ethanone |
| InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
1-(4-Bromo-3-nitrophenyl)ethan-1-one, 1-(4-Bromo-3-nitrophenyl)ethanone, 4'-Bromo-3'-nitroacetophenone, 4-Bromo-3-nitroacetophenone, 4-Bromo-3'-nitroacetophenone, Ethanone, 1-(4-bromo-3-nitrophenyl)-, 1-(4-Bromo-3-nitrophenyl)-ethanone, 1-(4-bromo-3-nitro-phenyl)-ethanone, 4'-Bromo-3'-nitroacetophenone, 97%, 3-Nitro-4-bromoacetophenone