cas: 18640-58-9 — see every product listed under this CAS number, including other names
1-(4-Bromo-3-nitrophenyl)ethanone, 98%, 98% (CAS 18640-58-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 50g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1186OH-250mg |
| cas | 18640-58-9 |
| size | 250mg |
| availability | 1500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 126.80 Pln | |
| Chemat | 10g | 170.00 Pln | |
| Chemat | 25g | 290.00 Pln | |
| Chemat | 100g | 976.40 Pln | |
| Chemat | 50g | 520.40 Pln | |
| Chemat | 500g | 3974.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-(4-bromo-3-nitrophenyl)ethanone (CAS 18640-58-9) is a chemical compound with the molecular formula C8H6BrNO3 and a molecular weight of 244.04 g/mol. IUPAC name: 1-(4-bromo-3-nitrophenyl)ethanone. InChIKey: YFVOFFKNHQTQQE-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO3 |
|---|---|
| Molecular weight | 244.04 g/mol |
| IUPAC name | 1-(4-bromo-3-nitrophenyl)ethanone |
| InChIKey | YFVOFFKNHQTQQE-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC(=C(C=C1)Br)[N+](=O)[O-] |
Computed by PubChem (NCBI)