cas: 173974-88-4 — see every product listed under this CAS number, including other names
1-(4-Bromophenyl)-2,2-difluoroethanone 95% (CAS 173974-88-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A764823-100mg |
| cas | 173974-88-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 815.38 Pln | |
| Ambeed | 250mg | 1104.63 Pln | |
| Ambeed | 1g | 2662.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A764823 |
1-(4-bromophenyl)-2,2-difluoroethanone (CAS 173974-88-4) is a chemical compound with the molecular formula C8H5BrF2O and a molecular weight of 235.02 g/mol. IUPAC name: 1-(4-bromophenyl)-2,2-difluoroethanone. InChIKey: AULWQWKDUPKRJT-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF2O |
|---|---|
| Molecular weight | 235.02 g/mol |
| IUPAC name | 1-(4-bromophenyl)-2,2-difluoroethanone |
| InChIKey | AULWQWKDUPKRJT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(F)F)Br |
Computed by PubChem (NCBI)